C11H15N3S — CID 91452477
ethane;5-methyl-N-pyridin-2-yl-1,3-thiazol-2-amine (PubChem CID 91452477) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is ethane;5-methyl-N-pyridin-2-yl-1,3-thiazol-2-amine.
| Compound Name | ethane;5-methyl-N-pyridin-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 91452477 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | ethane;5-methyl-N-pyridin-2-yl-1,3-thiazol-2-amine |
| SMILES | CC.Cc1cnc(Nc2ccccn2)s1 |
| InChI | InChI=1S/C9H9N3S.C2H6/c1-7-6-11-9(13-7)12-8-4-2-3-5-10-8;1-2/h2-6H,1H3,(H,10,11,12);1-2H3 |
| InChIKey | VGPQQHMMJYXNGE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |