About 2-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile
2-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile (PubChem CID 107543448) has the molecular formula C9H7N5S
and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile |
| PubChem CID | 107543448 |
| Molecular Formula | C9H7N5S |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 2-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile |
| SMILES | Cc1cnc(Nc2nccc(C#N)n2)s1 |
| InChI | InChI=1S/C9H7N5S/c1-6-5-12-9(15-6)14-8-11-3-2-7(4-10)13-8/h2-3,5H,1H3,(H,11,12,13,14) |
| InChIKey | SBZLLTSBDQOTFZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile?
The IUPAC name of 2-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile (CID 107543448) is 2-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile.
What is the SMILES notation for 2-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile?
The canonical SMILES for 2-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile is Cc1cnc(Nc2nccc(C#N)n2)s1.
What is the InChIKey of 2-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile?
The InChIKey is SBZLLTSBDQOTFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N5S/c1-6-5-12-9(15-6)14-8-11-3-2-7(4-10)13-8/h2-3,5H,1H3,(H,11,12,13,14).
What are the key properties of 2-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile?
2-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile has a molecular weight of 217.26 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidine-4-carbonitrile is sourced from PubChem (CID 107543448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).