C10H5F5N4 — CID 116797163
2-N-(2,3,4,5,6-pentafluorophenyl)pyrimidine-2,4-diamine (PubChem CID 116797163) has the molecular formula C10H5F5N4 and a molecular weight of 276.17 g/mol. Its IUPAC name is 2-N-(2,3,4,5,6-pentafluorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2,3,4,5,6-pentafluorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116797163 |
| Molecular Formula | C10H5F5N4 |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 2-N-(2,3,4,5,6-pentafluorophenyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ccnc(Nc2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C10H5F5N4/c11-4-5(12)7(14)9(8(15)6(4)13)19-10-17-2-1-3(16)18-10/h1-2H,(H3,16,17,18,19) |
| InChIKey | LVPSHQLMTBJRCH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|