C15H19N5 — CID 116796160
2-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 116796160) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116796160 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ccnc(Nc2ccc(N3CCCCC3)cc2)n1 |
| InChI | InChI=1S/C15H19N5/c16-14-8-9-17-15(19-14)18-12-4-6-13(7-5-12)20-10-2-1-3-11-20/h4-9H,1-3,10-11H2,(H3,16,17,18,19) |
| InChIKey | LSDPEQUFYVZTSS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|