C16H20N4 — CID 63179146
2-N-(4-piperidin-1-ylphenyl)pyridine-2,4-diamine (PubChem CID 63179146) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-N-(4-piperidin-1-ylphenyl)pyridine-2,4-diamine.
| Compound Name | 2-N-(4-piperidin-1-ylphenyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 63179146 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2-N-(4-piperidin-1-ylphenyl)pyridine-2,4-diamine |
| SMILES | Nc1ccnc(Nc2ccc(N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C16H20N4/c17-13-8-9-18-16(12-13)19-14-4-6-15(7-5-14)20-10-2-1-3-11-20/h4-9,12H,1-3,10-11H2,(H3,17,18,19) |
| InChIKey | AFUZUTJBIQLNFN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|