C14H17N5 — CID 79917986
4-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-4,5-diamine (PubChem CID 79917986) has the molecular formula C14H17N5 and a molecular weight of 255.33 g/mol. Its IUPAC name is 4-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 79917986 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 4-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-4,5-diamine |
| SMILES | Nc1cncnc1Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C14H17N5/c15-13-9-16-10-17-14(13)18-11-3-5-12(6-4-11)19-7-1-2-8-19/h3-6,9-10H,1-2,7-8,15H2,(H,16,17,18) |
| InChIKey | OUBDYGPXASXCFI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|