C16H17N5 — CID 103468392
5-amino-6-(4-pyrrolidin-1-ylanilino)pyridine-3-carbonitrile (PubChem CID 103468392) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 5-amino-6-(4-pyrrolidin-1-ylanilino)pyridine-3-carbonitrile.
| Compound Name | 5-amino-6-(4-pyrrolidin-1-ylanilino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103468392 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 5-amino-6-(4-pyrrolidin-1-ylanilino)pyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(Nc2ccc(N3CCCC3)cc2)c(N)c1 |
| InChI | InChI=1S/C16H17N5/c17-10-12-9-15(18)16(19-11-12)20-13-3-5-14(6-4-13)21-7-1-2-8-21/h3-6,9,11H,1-2,7-8,18H2,(H,19,20) |
| InChIKey | WYIMADDNSDPOFG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|