C12H12N4O2 — CID 79915694
4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrimidine-4,5-diamine (PubChem CID 79915694) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 79915694 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 4-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrimidine-4,5-diamine |
| SMILES | Nc1cncnc1Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H12N4O2/c13-9-6-14-7-15-12(9)16-8-1-2-10-11(5-8)18-4-3-17-10/h1-2,5-7H,3-4,13H2,(H,14,15,16) |
| InChIKey | LKGONZFTYORDDR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |