C14H18N6 — CID 22543393
6-piperidin-1-yl-4-N-pyridin-4-ylpyrimidine-4,5-diamine (PubChem CID 22543393) has the molecular formula C14H18N6 and a molecular weight of 270.34 g/mol. Its IUPAC name is 6-piperidin-1-yl-4-N-pyridin-4-ylpyrimidine-4,5-diamine.
| Compound Name | 6-piperidin-1-yl-4-N-pyridin-4-ylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22543393 |
| Molecular Formula | C14H18N6 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 6-piperidin-1-yl-4-N-pyridin-4-ylpyrimidine-4,5-diamine |
| SMILES | Nc1c(Nc2ccncc2)ncnc1N1CCCCC1 |
| InChI | InChI=1S/C14H18N6/c15-12-13(19-11-4-6-16-7-5-11)17-10-18-14(12)20-8-2-1-3-9-20/h4-7,10H,1-3,8-9,15H2,(H,16,17,18,19) |
| InChIKey | SYVBDVHGLVUMHY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |