C18H26N6 — CID 141379231
3-N-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1H-pyrazole-3,5-diamine (PubChem CID 141379231) has the molecular formula C18H26N6 and a molecular weight of 326.45 g/mol. Its IUPAC name is 3-N-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1H-pyrazole-3,5-diamine.
| Compound Name | 3-N-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 141379231 |
| Molecular Formula | C18H26N6 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 3-N-[4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1H-pyrazole-3,5-diamine |
| SMILES | Nc1cc(Nc2ccc(N3CCC(N4CCCC4)CC3)cc2)n[nH]1 |
| InChI | InChI=1S/C18H26N6/c19-17-13-18(22-21-17)20-14-3-5-15(6-4-14)24-11-7-16(8-12-24)23-9-1-2-10-23/h3-6,13,16H,1-2,7-12H2,(H4,19,20,21,22) |
| InChIKey | KTWKPXDFZREDGY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|