C20H27N5 — CID 112909930
2-N-cyclopentyl-6-methyl-4-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 112909930) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-N-cyclopentyl-6-methyl-4-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-cyclopentyl-6-methyl-4-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112909930 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 2-N-cyclopentyl-6-methyl-4-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ccc(N3CCCC3)cc2)nc(NC2CCCC2)n1 |
| InChI | InChI=1S/C20H27N5/c1-15-14-19(24-20(21-15)23-16-6-2-3-7-16)22-17-8-10-18(11-9-17)25-12-4-5-13-25/h8-11,14,16H,2-7,12-13H2,1H3,(H2,21,22,23,24) |
| InChIKey | MVYFMUYCMNIMFV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|