C19H22N6O — CID 112931774
6-methyl-2-N-(5-methyl-1,2-oxazol-3-yl)-4-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 112931774) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is 6-methyl-2-N-(5-methyl-1,2-oxazol-3-yl)-4-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 6-methyl-2-N-(5-methyl-1,2-oxazol-3-yl)-4-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112931774 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 6-methyl-2-N-(5-methyl-1,2-oxazol-3-yl)-4-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ccc(N3CCCC3)cc2)nc(Nc2cc(C)on2)n1 |
| InChI | InChI=1S/C19H22N6O/c1-13-11-17(22-19(20-13)23-18-12-14(2)26-24-18)21-15-5-7-16(8-6-15)25-9-3-4-10-25/h5-8,11-12H,3-4,9-10H2,1-2H3,(H2,20,21,22,23,24) |
| InChIKey | KJOKRQKTXVXMDJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|