C20H24N6O — CID 112931796
6-methyl-2-N-(5-methyl-1,2-oxazol-3-yl)-4-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 112931796) has the molecular formula C20H24N6O and a molecular weight of 364.45 g/mol. Its IUPAC name is 6-methyl-2-N-(5-methyl-1,2-oxazol-3-yl)-4-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 6-methyl-2-N-(5-methyl-1,2-oxazol-3-yl)-4-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112931796 |
| Molecular Formula | C20H24N6O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 6-methyl-2-N-(5-methyl-1,2-oxazol-3-yl)-4-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ccc(N3CCCCC3)cc2)nc(Nc2cc(C)on2)n1 |
| InChI | InChI=1S/C20H24N6O/c1-14-12-18(23-20(21-14)24-19-13-15(2)27-25-19)22-16-6-8-17(9-7-16)26-10-4-3-5-11-26/h6-9,12-13H,3-5,10-11H2,1-2H3,(H2,21,22,23,24,25) |
| InChIKey | BVZSXMIIPYLYJJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|