C24H27N5 — CID 112933212
2-N-cyclopropyl-6-phenyl-4-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 112933212) has the molecular formula C24H27N5 and a molecular weight of 385.52 g/mol. Its IUPAC name is 2-N-cyclopropyl-6-phenyl-4-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-cyclopropyl-6-phenyl-4-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112933212 |
| Molecular Formula | C24H27N5 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 2-N-cyclopropyl-6-phenyl-4-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | c1ccc(-c2cc(Nc3ccc(N4CCCCC4)cc3)nc(NC3CC3)n2)cc1 |
| InChI | InChI=1S/C24H27N5/c1-3-7-18(8-4-1)22-17-23(28-24(27-22)26-20-9-10-20)25-19-11-13-21(14-12-19)29-15-5-2-6-16-29/h1,3-4,7-8,11-14,17,20H,2,5-6,9-10,15-16H2,(H2,25,26,27,28) |
| InChIKey | FCGXYFWWDUAHLY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|