C22H19N5 — CID 112933219
2-N-cyclopropyl-6-phenyl-4-N-quinolin-8-ylpyrimidine-2,4-diamine (PubChem CID 112933219) has the molecular formula C22H19N5 and a molecular weight of 353.43 g/mol. Its IUPAC name is 2-N-cyclopropyl-6-phenyl-4-N-quinolin-8-ylpyrimidine-2,4-diamine.
| Compound Name | 2-N-cyclopropyl-6-phenyl-4-N-quinolin-8-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112933219 |
| Molecular Formula | C22H19N5 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2-N-cyclopropyl-6-phenyl-4-N-quinolin-8-ylpyrimidine-2,4-diamine |
| SMILES | c1ccc(-c2cc(Nc3cccc4cccnc34)nc(NC3CC3)n2)cc1 |
| InChI | InChI=1S/C22H19N5/c1-2-6-15(7-3-1)19-14-20(27-22(26-19)24-17-11-12-17)25-18-10-4-8-16-9-5-13-23-21(16)18/h1-10,13-14,17H,11-12H2,(H2,24,25,26,27) |
| InChIKey | GOEYRNXQVHMSSI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |