C15H20N6 — CID 80812289
4-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4,6-triamine (PubChem CID 80812289) has the molecular formula C15H20N6 and a molecular weight of 284.37 g/mol. Its IUPAC name is 4-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80812289 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 4-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4,6-triamine |
| SMILES | Nc1cc(Nc2ccc(N3CCCCC3)cc2)nc(N)n1 |
| InChI | InChI=1S/C15H20N6/c16-13-10-14(20-15(17)19-13)18-11-4-6-12(7-5-11)21-8-2-1-3-9-21/h4-7,10H,1-3,8-9H2,(H5,16,17,18,19,20) |
| InChIKey | JQMZSDMGPZBMSX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|