C18H20N8O — CID 117089780
6-N-(4-morpholin-4-ylphenyl)-4-N-pyrimidin-4-ylpyrimidine-2,4,6-triamine (PubChem CID 117089780) has the molecular formula C18H20N8O and a molecular weight of 364.41 g/mol. Its IUPAC name is 6-N-(4-morpholin-4-ylphenyl)-4-N-pyrimidin-4-ylpyrimidine-2,4,6-triamine.
| Compound Name | 6-N-(4-morpholin-4-ylphenyl)-4-N-pyrimidin-4-ylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 117089780 |
| Molecular Formula | C18H20N8O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 6-N-(4-morpholin-4-ylphenyl)-4-N-pyrimidin-4-ylpyrimidine-2,4,6-triamine |
| SMILES | Nc1nc(Nc2ccc(N3CCOCC3)cc2)cc(Nc2ccncn2)n1 |
| InChI | InChI=1S/C18H20N8O/c19-18-24-16(11-17(25-18)23-15-5-6-20-12-21-15)22-13-1-3-14(4-2-13)26-7-9-27-10-8-26/h1-6,11-12H,7-10H2,(H4,19,20,21,22,23,24,25) |
| InChIKey | RJXFMNRRJXVFJK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 114.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|