C14H16ClN5O — CID 121468961
6-chloro-2-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 121468961) has the molecular formula C14H16ClN5O and a molecular weight of 305.77 g/mol. Its IUPAC name is 6-chloro-2-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 121468961 |
| Molecular Formula | C14H16ClN5O |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 6-chloro-2-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | Nc1cc(Cl)nc(Nc2ccc(N3CCOCC3)cc2)n1 |
| InChI | InChI=1S/C14H16ClN5O/c15-12-9-13(16)19-14(18-12)17-10-1-3-11(4-2-10)20-5-7-21-8-6-20/h1-4,9H,5-8H2,(H3,16,17,18,19) |
| InChIKey | CTLLDZGJHFMQHD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|