C19H23ClFN5 — CID 167225907
4-chloro-6-[(3R)-3-fluoropyrrolidin-1-yl]-N-(4-piperidin-1-ylphenyl)pyrimidin-2-amine (PubChem CID 167225907) has the molecular formula C19H23ClFN5 and a molecular weight of 375.88 g/mol. Its IUPAC name is 4-chloro-6-[(3R)-3-fluoropyrrolidin-1-yl]-N-(4-piperidin-1-ylphenyl)pyrimidin-2-amine.
| Compound Name | 4-chloro-6-[(3R)-3-fluoropyrrolidin-1-yl]-N-(4-piperidin-1-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 167225907 |
| Molecular Formula | C19H23ClFN5 |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 4-chloro-6-[(3R)-3-fluoropyrrolidin-1-yl]-N-(4-piperidin-1-ylphenyl)pyrimidin-2-amine |
| SMILES | F[C@@H]1CCN(c2cc(Cl)nc(Nc3ccc(N4CCCCC4)cc3)n2)C1 |
| InChI | InChI=1S/C19H23ClFN5/c20-17-12-18(26-11-8-14(21)13-26)24-19(23-17)22-15-4-6-16(7-5-15)25-9-2-1-3-10-25/h4-7,12,14H,1-3,8-11,13H2,(H,22,23,24)/t14-/m1/s1 |
| InChIKey | SAJYAXJCVZULTB-CQSZACIVSA-N |
| XLogP | 4.41 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|