C17H20Cl2N4 — CID 112926654
4-(azepan-1-yl)-N-(3,4-dichlorophenyl)-6-methylpyrimidin-2-amine (PubChem CID 112926654) has the molecular formula C17H20Cl2N4 and a molecular weight of 351.28 g/mol. Its IUPAC name is 4-(azepan-1-yl)-N-(3,4-dichlorophenyl)-6-methylpyrimidin-2-amine.
| Compound Name | 4-(azepan-1-yl)-N-(3,4-dichlorophenyl)-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112926654 |
| Molecular Formula | C17H20Cl2N4 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-(azepan-1-yl)-N-(3,4-dichlorophenyl)-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc(N2CCCCCC2)nc(Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C17H20Cl2N4/c1-12-10-16(23-8-4-2-3-5-9-23)22-17(20-12)21-13-6-7-14(18)15(19)11-13/h6-7,10-11H,2-5,8-9H2,1H3,(H,20,21,22) |
| InChIKey | ZKNCSRTVUOWFSU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |