C22H24ClN5O2S — CID 27478593
4-chloro-N-[4-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]phenyl]benzenesulfonamide (PubChem CID 27478593) has the molecular formula C22H24ClN5O2S and a molecular weight of 457.99 g/mol. Its IUPAC name is 4-chloro-N-[4-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]phenyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[4-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 27478593 |
| Molecular Formula | C22H24ClN5O2S |
| Molecular Weight | 457.99 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 4-chloro-N-[4-[(4-methyl-6-piperidin-1-ylpyrimidin-2-yl)amino]phenyl]benzenesulfonamide |
| SMILES | Cc1cc(N2CCCCC2)nc(Nc2ccc(NS(=O)(=O)c3ccc(Cl)cc3)cc2)n1 |
| InChI | InChI=1S/C22H24ClN5O2S/c1-16-15-21(28-13-3-2-4-14-28)26-22(24-16)25-18-7-9-19(10-8-18)27-31(29,30)20-11-5-17(23)6-12-20/h5-12,15,27H,2-4,13-14H2,1H3,(H,24,25,26) |
| InChIKey | JMCMXMPKCBKYTE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.99 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |