C17H18ClF3N4 — CID 112910130
N-[4-chloro-3-(trifluoromethyl)phenyl]-4-methyl-6-piperidin-1-ylpyrimidin-2-amine (PubChem CID 112910130) has the molecular formula C17H18ClF3N4 and a molecular weight of 370.81 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-4-methyl-6-piperidin-1-ylpyrimidin-2-amine.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-4-methyl-6-piperidin-1-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112910130 |
| Molecular Formula | C17H18ClF3N4 |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-4-methyl-6-piperidin-1-ylpyrimidin-2-amine |
| SMILES | Cc1cc(N2CCCCC2)nc(Nc2ccc(Cl)c(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C17H18ClF3N4/c1-11-9-15(25-7-3-2-4-8-25)24-16(22-11)23-12-5-6-14(18)13(10-12)17(19,20)21/h5-6,9-10H,2-4,7-8H2,1H3,(H,22,23,24) |
| InChIKey | TXAGFRFKNDKREP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |