C19H26N4 — CID 112926580
4-(azepan-1-yl)-N-(2,6-dimethylphenyl)-6-methylpyrimidin-2-amine (PubChem CID 112926580) has the molecular formula C19H26N4 and a molecular weight of 310.45 g/mol. Its IUPAC name is 4-(azepan-1-yl)-N-(2,6-dimethylphenyl)-6-methylpyrimidin-2-amine.
| Compound Name | 4-(azepan-1-yl)-N-(2,6-dimethylphenyl)-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112926580 |
| Molecular Formula | C19H26N4 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 4-(azepan-1-yl)-N-(2,6-dimethylphenyl)-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc(N2CCCCCC2)nc(Nc2c(C)cccc2C)n1 |
| InChI | InChI=1S/C19H26N4/c1-14-9-8-10-15(2)18(14)22-19-20-16(3)13-17(21-19)23-11-6-4-5-7-12-23/h8-10,13H,4-7,11-12H2,1-3H3,(H,20,21,22) |
| InChIKey | PBJURKXIONFRIZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |