C17H19F3N4 — CID 112926668
4-(azepan-1-yl)-6-methyl-N-(2,3,4-trifluorophenyl)pyrimidin-2-amine (PubChem CID 112926668) has the molecular formula C17H19F3N4 and a molecular weight of 336.36 g/mol. Its IUPAC name is 4-(azepan-1-yl)-6-methyl-N-(2,3,4-trifluorophenyl)pyrimidin-2-amine.
| Compound Name | 4-(azepan-1-yl)-6-methyl-N-(2,3,4-trifluorophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112926668 |
| Molecular Formula | C17H19F3N4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-(azepan-1-yl)-6-methyl-N-(2,3,4-trifluorophenyl)pyrimidin-2-amine |
| SMILES | Cc1cc(N2CCCCCC2)nc(Nc2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C17H19F3N4/c1-11-10-14(24-8-4-2-3-5-9-24)23-17(21-11)22-13-7-6-12(18)15(19)16(13)20/h6-7,10H,2-5,8-9H2,1H3,(H,21,22,23) |
| InChIKey | YMEYYVHCCPDMRP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|