C15H15F3N4 — CID 112856176
6-piperidin-1-yl-N-(2,3,4-trifluorophenyl)pyrimidin-4-amine (PubChem CID 112856176) has the molecular formula C15H15F3N4 and a molecular weight of 308.31 g/mol. Its IUPAC name is 6-piperidin-1-yl-N-(2,3,4-trifluorophenyl)pyrimidin-4-amine.
| Compound Name | 6-piperidin-1-yl-N-(2,3,4-trifluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112856176 |
| Molecular Formula | C15H15F3N4 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 6-piperidin-1-yl-N-(2,3,4-trifluorophenyl)pyrimidin-4-amine |
| SMILES | Fc1ccc(Nc2cc(N3CCCCC3)ncn2)c(F)c1F |
| InChI | InChI=1S/C15H15F3N4/c16-10-4-5-11(15(18)14(10)17)21-12-8-13(20-9-19-12)22-6-2-1-3-7-22/h4-5,8-9H,1-3,6-7H2,(H,19,20,21) |
| InChIKey | JYAPMCCHRIFGDO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|