C16H17F3N4 — CID 112910147
4-methyl-6-piperidin-1-yl-N-(2,3,4-trifluorophenyl)pyrimidin-2-amine (PubChem CID 112910147) has the molecular formula C16H17F3N4 and a molecular weight of 322.33 g/mol. Its IUPAC name is 4-methyl-6-piperidin-1-yl-N-(2,3,4-trifluorophenyl)pyrimidin-2-amine.
| Compound Name | 4-methyl-6-piperidin-1-yl-N-(2,3,4-trifluorophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112910147 |
| Molecular Formula | C16H17F3N4 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 4-methyl-6-piperidin-1-yl-N-(2,3,4-trifluorophenyl)pyrimidin-2-amine |
| SMILES | Cc1cc(N2CCCCC2)nc(Nc2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C16H17F3N4/c1-10-9-13(23-7-3-2-4-8-23)22-16(20-10)21-12-6-5-11(17)14(18)15(12)19/h5-6,9H,2-4,7-8H2,1H3,(H,20,21,22) |
| InChIKey | IRNNSCCVIDQQLZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|