C12H9F3N4S — CID 107546277
6-methyl-2-(2,3,4-trifluoroanilino)pyrimidine-4-carbothioamide (PubChem CID 107546277) has the molecular formula C12H9F3N4S and a molecular weight of 298.29 g/mol. Its IUPAC name is 6-methyl-2-(2,3,4-trifluoroanilino)pyrimidine-4-carbothioamide.
| Compound Name | 6-methyl-2-(2,3,4-trifluoroanilino)pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107546277 |
| Molecular Formula | C12H9F3N4S |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 6-methyl-2-(2,3,4-trifluoroanilino)pyrimidine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)nc(Nc2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C12H9F3N4S/c1-5-4-8(11(16)20)19-12(17-5)18-7-3-2-6(13)9(14)10(7)15/h2-4H,1H3,(H2,16,20)(H,17,18,19) |
| InChIKey | SHSKUKGUERGSLV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|