C13H12F2N4S — CID 107547881
2-(2,6-difluoro-3-methylanilino)-6-methylpyrimidine-4-carbothioamide (PubChem CID 107547881) has the molecular formula C13H12F2N4S and a molecular weight of 294.33 g/mol. Its IUPAC name is 2-(2,6-difluoro-3-methylanilino)-6-methylpyrimidine-4-carbothioamide.
| Compound Name | 2-(2,6-difluoro-3-methylanilino)-6-methylpyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107547881 |
| Molecular Formula | C13H12F2N4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-(2,6-difluoro-3-methylanilino)-6-methylpyrimidine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)nc(Nc2c(F)ccc(C)c2F)n1 |
| InChI | InChI=1S/C13H12F2N4S/c1-6-3-4-8(14)11(10(6)15)19-13-17-7(2)5-9(18-13)12(16)20/h3-5H,1-2H3,(H2,16,20)(H,17,18,19) |
| InChIKey | CNNBDMZYXSNXBE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|