C13H11F2N3S — CID 82818596
5-(2,6-difluoro-3-methylanilino)pyridine-2-carbothioamide (PubChem CID 82818596) has the molecular formula C13H11F2N3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 5-(2,6-difluoro-3-methylanilino)pyridine-2-carbothioamide.
| Compound Name | 5-(2,6-difluoro-3-methylanilino)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 82818596 |
| Molecular Formula | C13H11F2N3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 5-(2,6-difluoro-3-methylanilino)pyridine-2-carbothioamide |
| SMILES | Cc1ccc(F)c(Nc2ccc(C(N)=S)nc2)c1F |
| InChI | InChI=1S/C13H11F2N3S/c1-7-2-4-9(14)12(11(7)15)18-8-3-5-10(13(16)19)17-6-8/h2-6,18H,1H3,(H2,16,19) |
| InChIKey | KAFQULMDOMKWOX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|