C15H17ClN4 — CID 112855741
N-(5-chloro-2-methylphenyl)-6-pyrrolidin-1-ylpyrimidin-4-amine (PubChem CID 112855741) has the molecular formula C15H17ClN4 and a molecular weight of 288.78 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-6-pyrrolidin-1-ylpyrimidin-4-amine.
| Compound Name | N-(5-chloro-2-methylphenyl)-6-pyrrolidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112855741 |
| Molecular Formula | C15H17ClN4 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-6-pyrrolidin-1-ylpyrimidin-4-amine |
| SMILES | Cc1ccc(Cl)cc1Nc1cc(N2CCCC2)ncn1 |
| InChI | InChI=1S/C15H17ClN4/c1-11-4-5-12(16)8-13(11)19-14-9-15(18-10-17-14)20-6-2-3-7-20/h4-5,8-10H,2-3,6-7H2,1H3,(H,17,18,19) |
| InChIKey | YXEPKQYMHLKHKQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |