C14H15ClN4 — CID 112854987
4-N-(5-chloro-2-methylphenyl)-6-N-prop-2-enylpyrimidine-4,6-diamine (PubChem CID 112854987) has the molecular formula C14H15ClN4 and a molecular weight of 274.76 g/mol. Its IUPAC name is 4-N-(5-chloro-2-methylphenyl)-6-N-prop-2-enylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(5-chloro-2-methylphenyl)-6-N-prop-2-enylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112854987 |
| Molecular Formula | C14H15ClN4 |
| Molecular Weight | 274.76 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-N-(5-chloro-2-methylphenyl)-6-N-prop-2-enylpyrimidine-4,6-diamine |
| SMILES | C=CCNc1cc(Nc2cc(Cl)ccc2C)ncn1 |
| InChI | InChI=1S/C14H15ClN4/c1-3-6-16-13-8-14(18-9-17-13)19-12-7-11(15)5-4-10(12)2/h3-5,7-9H,1,6H2,2H3,(H2,16,17,18,19) |
| InChIKey | XDKMPDIJBUBVGL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.76 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|