C17H21ClN4 — CID 112856110
N-(2-chloro-4,6-dimethylphenyl)-6-piperidin-1-ylpyrimidin-4-amine (PubChem CID 112856110) has the molecular formula C17H21ClN4 and a molecular weight of 316.84 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-6-piperidin-1-ylpyrimidin-4-amine.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-6-piperidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112856110 |
| Molecular Formula | C17H21ClN4 |
| Molecular Weight | 316.84 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-6-piperidin-1-ylpyrimidin-4-amine |
| SMILES | Cc1cc(C)c(Nc2cc(N3CCCCC3)ncn2)c(Cl)c1 |
| InChI | InChI=1S/C17H21ClN4/c1-12-8-13(2)17(14(18)9-12)21-15-10-16(20-11-19-15)22-6-4-3-5-7-22/h8-11H,3-7H2,1-2H3,(H,19,20,21) |
| InChIKey | WDJQFDWODHXHAE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.84 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |