C14H14BrFN4O — CID 122282510
N-(4-bromo-2-fluorophenyl)-6-morpholin-4-ylpyrimidin-4-amine (PubChem CID 122282510) has the molecular formula C14H14BrFN4O and a molecular weight of 353.20 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-6-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | N-(4-bromo-2-fluorophenyl)-6-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 122282510 |
| Molecular Formula | C14H14BrFN4O |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-6-morpholin-4-ylpyrimidin-4-amine |
| SMILES | Fc1cc(Br)ccc1Nc1cc(N2CCOCC2)ncn1 |
| InChI | InChI=1S/C14H14BrFN4O/c15-10-1-2-12(11(16)7-10)19-13-8-14(18-9-17-13)20-3-5-21-6-4-20/h1-2,7-9H,3-6H2,(H,17,18,19) |
| InChIKey | SIBLOSCMGQCIJB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |