C14H14N6OS — CID 122282532
N-(6-morpholin-4-ylpyrimidin-4-yl)-2,1,3-benzothiadiazol-4-amine (PubChem CID 122282532) has the molecular formula C14H14N6OS and a molecular weight of 314.37 g/mol. Its IUPAC name is N-(6-morpholin-4-ylpyrimidin-4-yl)-2,1,3-benzothiadiazol-4-amine.
| Compound Name | N-(6-morpholin-4-ylpyrimidin-4-yl)-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 122282532 |
| Molecular Formula | C14H14N6OS |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-(6-morpholin-4-ylpyrimidin-4-yl)-2,1,3-benzothiadiazol-4-amine |
| SMILES | c1cc(Nc2cc(N3CCOCC3)ncn2)c2nsnc2c1 |
| InChI | InChI=1S/C14H14N6OS/c1-2-10(14-11(3-1)18-22-19-14)17-12-8-13(16-9-15-12)20-4-6-21-7-5-20/h1-3,8-9H,4-7H2,(H,15,16,17) |
| InChIKey | LFEBQKXZOFOLEB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 76.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |