C18H17ClN4O2 — CID 86649544
6-chloro-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one (PubChem CID 86649544) has the molecular formula C18H17ClN4O2 and a molecular weight of 356.81 g/mol. Its IUPAC name is 6-chloro-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one.
| Compound Name | 6-chloro-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 86649544 |
| Molecular Formula | C18H17ClN4O2 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 6-chloro-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one |
| SMILES | O=c1[nH]ccc2cc(Cl)nc(Nc3ccc(N4CCOCC4)cc3)c12 |
| InChI | InChI=1S/C18H17ClN4O2/c19-15-11-12-5-6-20-18(24)16(12)17(22-15)21-13-1-3-14(4-2-13)23-7-9-25-10-8-23/h1-6,11H,7-10H2,(H,20,24)(H,21,22) |
| InChIKey | GYYJVRWETGYISF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|