C17H16ClN5O2 — CID 135870849
7-chloro-5-(4-morpholin-4-ylanilino)-3H-pyrido[4,3-d]pyrimidin-4-one (PubChem CID 135870849) has the molecular formula C17H16ClN5O2 and a molecular weight of 357.80 g/mol. Its IUPAC name is 7-chloro-5-(4-morpholin-4-ylanilino)-3H-pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 7-chloro-5-(4-morpholin-4-ylanilino)-3H-pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135870849 |
| Molecular Formula | C17H16ClN5O2 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 7-chloro-5-(4-morpholin-4-ylanilino)-3H-pyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2cc(Cl)nc(Nc3ccc(N4CCOCC4)cc3)c12 |
| InChI | InChI=1S/C17H16ClN5O2/c18-14-9-13-15(17(24)20-10-19-13)16(22-14)21-11-1-3-12(4-2-11)23-5-7-25-8-6-23/h1-4,9-10H,5-8H2,(H,21,22)(H,19,20,24) |
| InChIKey | AWRQXPPOAVBQBB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|