C24H28N6O2 — CID 66887642
6-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one (PubChem CID 66887642) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 6-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one.
| Compound Name | 6-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 66887642 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 6-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one |
| SMILES | O=c1[nH]ccc2cc(N3C[C@@H]4CNC[C@H]4C3)nc(Nc3ccc(N4CCOCC4)cc3)c12 |
| InChI | InChI=1S/C24H28N6O2/c31-24-22-16(5-6-26-24)11-21(30-14-17-12-25-13-18(17)15-30)28-23(22)27-19-1-3-20(4-2-19)29-7-9-32-10-8-29/h1-6,11,17-18,25H,7-10,12-15H2,(H,26,31)(H,27,28)/t17-,18-/m0/s1 |
| InChIKey | NAYLHJWPUPGNBO-ROUUACIJSA-N |
| XLogP | 2.16 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|