C19H21N5O — CID 174694546
6-methyl-8-(4-piperazin-1-ylanilino)-2H-2,7-naphthyridin-1-one (PubChem CID 174694546) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 6-methyl-8-(4-piperazin-1-ylanilino)-2H-2,7-naphthyridin-1-one.
| Compound Name | 6-methyl-8-(4-piperazin-1-ylanilino)-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 174694546 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 6-methyl-8-(4-piperazin-1-ylanilino)-2H-2,7-naphthyridin-1-one |
| SMILES | Cc1cc2cc[nH]c(=O)c2c(Nc2ccc(N3CCNCC3)cc2)n1 |
| InChI | InChI=1S/C19H21N5O/c1-13-12-14-6-7-21-19(25)17(14)18(22-13)23-15-2-4-16(5-3-15)24-10-8-20-9-11-24/h2-7,12,20H,8-11H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | YEFLKMZYVPXGOJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|