C26H26N4O3S — CID 58093617
6-(2-methyl-3-methylsulfinylphenyl)-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one (PubChem CID 58093617) has the molecular formula C26H26N4O3S and a molecular weight of 474.59 g/mol. Its IUPAC name is 6-(2-methyl-3-methylsulfinylphenyl)-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one.
| Compound Name | 6-(2-methyl-3-methylsulfinylphenyl)-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 58093617 |
| Molecular Formula | C26H26N4O3S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 6-(2-methyl-3-methylsulfinylphenyl)-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one |
| SMILES | Cc1c(-c2cc3cc[nH]c(=O)c3c(Nc3ccc(N4CCOCC4)cc3)n2)cccc1S(C)=O |
| InChI | InChI=1S/C26H26N4O3S/c1-17-21(4-3-5-23(17)34(2)32)22-16-18-10-11-27-26(31)24(18)25(29-22)28-19-6-8-20(9-7-19)30-12-14-33-15-13-30/h3-11,16H,12-15H2,1-2H3,(H,27,31)(H,28,29) |
| InChIKey | HIOFUWWJAFGZQN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|