C25H24N4O4S — CID 66888045
6-(3-methylsulfonylphenyl)-8-(3-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one (PubChem CID 66888045) has the molecular formula C25H24N4O4S and a molecular weight of 476.56 g/mol. Its IUPAC name is 6-(3-methylsulfonylphenyl)-8-(3-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one.
| Compound Name | 6-(3-methylsulfonylphenyl)-8-(3-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 66888045 |
| Molecular Formula | C25H24N4O4S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 6-(3-methylsulfonylphenyl)-8-(3-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one |
| SMILES | CS(=O)(=O)c1cccc(-c2cc3cc[nH]c(=O)c3c(Nc3cccc(N4CCOCC4)c3)n2)c1 |
| InChI | InChI=1S/C25H24N4O4S/c1-34(31,32)21-7-2-4-17(14-21)22-15-18-8-9-26-25(30)23(18)24(28-22)27-19-5-3-6-20(16-19)29-10-12-33-13-11-29/h2-9,14-16H,10-13H2,1H3,(H,26,30)(H,27,28) |
| InChIKey | MSOXWTVIOGZHGK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |