C27H32N6O2 — CID 143841410
6-(2,3-dimethylanilino)-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one;methanamine (PubChem CID 143841410) has the molecular formula C27H32N6O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 6-(2,3-dimethylanilino)-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one;methanamine.
| Compound Name | 6-(2,3-dimethylanilino)-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one;methanamine |
|---|---|
| PubChem CID | 143841410 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 6-(2,3-dimethylanilino)-8-(4-morpholin-4-ylanilino)-2H-2,7-naphthyridin-1-one;methanamine |
| SMILES | CN.Cc1cccc(Nc2cc3cc[nH]c(=O)c3c(Nc3ccc(N4CCOCC4)cc3)n2)c1C |
| InChI | InChI=1S/C26H27N5O2.CH5N/c1-17-4-3-5-22(18(17)2)29-23-16-19-10-11-27-26(32)24(19)25(30-23)28-20-6-8-21(9-7-20)31-12-14-33-15-13-31;1-2/h3-11,16H,12-15H2,1-2H3,(H,27,32)(H2,28,29,30);2H2,1H3 |
| InChIKey | SILGBTSKSMRONO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|