C23H22N6O2 — CID 50925324
8-(4-morpholin-4-ylanilino)-6-(pyridin-2-ylamino)-2H-2,7-naphthyridin-1-one (PubChem CID 50925324) has the molecular formula C23H22N6O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 8-(4-morpholin-4-ylanilino)-6-(pyridin-2-ylamino)-2H-2,7-naphthyridin-1-one.
| Compound Name | 8-(4-morpholin-4-ylanilino)-6-(pyridin-2-ylamino)-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 50925324 |
| Molecular Formula | C23H22N6O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 8-(4-morpholin-4-ylanilino)-6-(pyridin-2-ylamino)-2H-2,7-naphthyridin-1-one |
| SMILES | O=c1[nH]ccc2cc(Nc3ccccn3)nc(Nc3ccc(N4CCOCC4)cc3)c12 |
| InChI | InChI=1S/C23H22N6O2/c30-23-21-16(8-10-25-23)15-20(27-19-3-1-2-9-24-19)28-22(21)26-17-4-6-18(7-5-17)29-11-13-31-14-12-29/h1-10,15H,11-14H2,(H,25,30)(H2,24,26,27,28) |
| InChIKey | KXZVWZIRFRITPA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|