C22H26N6O3 — CID 58494192
2-(4-hydroxypiperidin-1-yl)-4-(4-morpholin-4-ylanilino)-6H-pyrido[4,3-d]pyrimidin-5-one (PubChem CID 58494192) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-(4-hydroxypiperidin-1-yl)-4-(4-morpholin-4-ylanilino)-6H-pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 2-(4-hydroxypiperidin-1-yl)-4-(4-morpholin-4-ylanilino)-6H-pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 58494192 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 2-(4-hydroxypiperidin-1-yl)-4-(4-morpholin-4-ylanilino)-6H-pyrido[4,3-d]pyrimidin-5-one |
| SMILES | O=c1[nH]ccc2nc(N3CCC(O)CC3)nc(Nc3ccc(N4CCOCC4)cc3)c12 |
| InChI | InChI=1S/C22H26N6O3/c29-17-6-9-28(10-7-17)22-25-18-5-8-23-21(30)19(18)20(26-22)24-15-1-3-16(4-2-15)27-11-13-31-14-12-27/h1-5,8,17,29H,6-7,9-14H2,(H,23,30)(H,24,25,26) |
| InChIKey | KHJMBIAHNUWJPW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|