C22H28N8O2 — CID 71269177
4-[4-(4-ethylpiperazin-1-yl)anilino]-2-morpholin-4-yl-6H-pyrimido[4,5-d]pyridazin-5-one (PubChem CID 71269177) has the molecular formula C22H28N8O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 4-[4-(4-ethylpiperazin-1-yl)anilino]-2-morpholin-4-yl-6H-pyrimido[4,5-d]pyridazin-5-one.
| Compound Name | 4-[4-(4-ethylpiperazin-1-yl)anilino]-2-morpholin-4-yl-6H-pyrimido[4,5-d]pyridazin-5-one |
|---|---|
| PubChem CID | 71269177 |
| Molecular Formula | C22H28N8O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 4-[4-(4-ethylpiperazin-1-yl)anilino]-2-morpholin-4-yl-6H-pyrimido[4,5-d]pyridazin-5-one |
| SMILES | CCN1CCN(c2ccc(Nc3nc(N4CCOCC4)nc4cn[nH]c(=O)c34)cc2)CC1 |
| InChI | InChI=1S/C22H28N8O2/c1-2-28-7-9-29(10-8-28)17-5-3-16(4-6-17)24-20-19-18(15-23-27-21(19)31)25-22(26-20)30-11-13-32-14-12-30/h3-6,15H,2,7-14H2,1H3,(H,27,31)(H,24,25,26) |
| InChIKey | RKRKBWQJKNUFES-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|