C24H26N8O3 — CID 123534814
1-[4-[[2-(4-isocyanopiperidin-1-yl)-5-oxo-6H-pyrimido[4,5-d]pyridazin-4-yl]amino]phenyl]piperidine-4-carboxylic acid (PubChem CID 123534814) has the molecular formula C24H26N8O3 and a molecular weight of 474.53 g/mol. Its IUPAC name is 1-[4-[[2-(4-isocyanopiperidin-1-yl)-5-oxo-6H-pyrimido[4,5-d]pyridazin-4-yl]amino]phenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-[[2-(4-isocyanopiperidin-1-yl)-5-oxo-6H-pyrimido[4,5-d]pyridazin-4-yl]amino]phenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 123534814 |
| Molecular Formula | C24H26N8O3 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 1-[4-[[2-(4-isocyanopiperidin-1-yl)-5-oxo-6H-pyrimido[4,5-d]pyridazin-4-yl]amino]phenyl]piperidine-4-carboxylic acid |
| SMILES | [C-]#[N+]C1CCN(c2nc(Nc3ccc(N4CCC(C(=O)O)CC4)cc3)c3c(=O)[nH]ncc3n2)CC1 |
| InChI | InChI=1S/C24H26N8O3/c1-25-16-8-12-32(13-9-16)24-28-19-14-26-30-22(33)20(19)21(29-24)27-17-2-4-18(5-3-17)31-10-6-15(7-11-31)23(34)35/h2-5,14-16H,6-13H2,(H,30,33)(H,34,35)(H,27,28,29) |
| InChIKey | PNMUVZNPASSXDF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|