C25H34N10O — CID 135220528
N'-amino-1-[[4-[[2-(azepan-1-yl)-5-oxo-6H-pyrimido[4,5-d]pyridazin-4-yl]amino]phenyl]methyl]piperidine-4-carboximidamide (PubChem CID 135220528) has the molecular formula C25H34N10O and a molecular weight of 490.62 g/mol. Its IUPAC name is N'-amino-1-[[4-[[2-(azepan-1-yl)-5-oxo-6H-pyrimido[4,5-d]pyridazin-4-yl]amino]phenyl]methyl]piperidine-4-carboximidamide.
| Compound Name | N'-amino-1-[[4-[[2-(azepan-1-yl)-5-oxo-6H-pyrimido[4,5-d]pyridazin-4-yl]amino]phenyl]methyl]piperidine-4-carboximidamide |
|---|---|
| PubChem CID | 135220528 |
| Molecular Formula | C25H34N10O |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | N'-amino-1-[[4-[[2-(azepan-1-yl)-5-oxo-6H-pyrimido[4,5-d]pyridazin-4-yl]amino]phenyl]methyl]piperidine-4-carboximidamide |
| SMILES | N/N=C(\N)C1CCN(Cc2ccc(Nc3nc(N4CCCCCC4)nc4cn[nH]c(=O)c34)cc2)CC1 |
| InChI | InChI=1S/C25H34N10O/c26-22(32-27)18-9-13-34(14-10-18)16-17-5-7-19(8-6-17)29-23-21-20(15-28-33-24(21)36)30-25(31-23)35-11-3-1-2-4-12-35/h5-8,15,18H,1-4,9-14,16,27H2,(H2,26,32)(H,33,36)(H,29,30,31) |
| InChIKey | ZGVIICKETBJLPW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 154.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|