C23H23N7O2 — CID 135870882
5-(4-morpholin-4-ylanilino)-7-(pyridin-4-ylmethylamino)-3H-pyrido[4,3-d]pyrimidin-4-one (PubChem CID 135870882) has the molecular formula C23H23N7O2 and a molecular weight of 429.48 g/mol. Its IUPAC name is 5-(4-morpholin-4-ylanilino)-7-(pyridin-4-ylmethylamino)-3H-pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 5-(4-morpholin-4-ylanilino)-7-(pyridin-4-ylmethylamino)-3H-pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135870882 |
| Molecular Formula | C23H23N7O2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 5-(4-morpholin-4-ylanilino)-7-(pyridin-4-ylmethylamino)-3H-pyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2cc(NCc3ccncc3)nc(Nc3ccc(N4CCOCC4)cc3)c12 |
| InChI | InChI=1S/C23H23N7O2/c31-23-21-19(26-15-27-23)13-20(25-14-16-5-7-24-8-6-16)29-22(21)28-17-1-3-18(4-2-17)30-9-11-32-12-10-30/h1-8,13,15H,9-12,14H2,(H2,25,28,29)(H,26,27,31) |
| InChIKey | DQDOFWSJBCEJOI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|