C20H24N6O2 — CID 135870859
5-(3-aminopropylamino)-7-(4-morpholin-4-ylphenyl)-3H-pyrido[4,3-d]pyrimidin-4-one (PubChem CID 135870859) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 5-(3-aminopropylamino)-7-(4-morpholin-4-ylphenyl)-3H-pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 5-(3-aminopropylamino)-7-(4-morpholin-4-ylphenyl)-3H-pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135870859 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 5-(3-aminopropylamino)-7-(4-morpholin-4-ylphenyl)-3H-pyrido[4,3-d]pyrimidin-4-one |
| SMILES | NCCCNc1nc(-c2ccc(N3CCOCC3)cc2)cc2nc[nH]c(=O)c12 |
| InChI | InChI=1S/C20H24N6O2/c21-6-1-7-22-19-18-17(23-13-24-20(18)27)12-16(25-19)14-2-4-15(5-3-14)26-8-10-28-11-9-26/h2-5,12-13H,1,6-11,21H2,(H,22,25)(H,23,24,27) |
| InChIKey | BYMJZBWBTRKYPO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|