C14H8ClN5O — CID 135870875
4-[(7-chloro-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)amino]benzonitrile (PubChem CID 135870875) has the molecular formula C14H8ClN5O and a molecular weight of 297.71 g/mol. Its IUPAC name is 4-[(7-chloro-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)amino]benzonitrile.
| Compound Name | 4-[(7-chloro-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 135870875 |
| Molecular Formula | C14H8ClN5O |
| Molecular Weight | 297.71 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 4-[(7-chloro-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2nc(Cl)cc3nc[nH]c(=O)c23)cc1 |
| InChI | InChI=1S/C14H8ClN5O/c15-11-5-10-12(14(21)18-7-17-10)13(20-11)19-9-3-1-8(6-16)2-4-9/h1-5,7H,(H,19,20)(H,17,18,21) |
| InChIKey | BGHDAQHOZDVAKA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.71 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|