C12H6ClF3N4O — CID 136971361
4-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 136971361) has the molecular formula C12H6ClF3N4O and a molecular weight of 314.65 g/mol. Its IUPAC name is 4-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 136971361 |
| Molecular Formula | C12H6ClF3N4O |
| Molecular Weight | 314.65 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 4-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(Nc2nc[nH]c(=O)c2Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C12H6ClF3N4O/c13-9-10(18-5-19-11(9)21)20-7-2-1-6(4-17)8(3-7)12(14,15)16/h1-3,5H,(H2,18,19,20,21) |
| InChIKey | PFEPMMXGSYKGDG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.65 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |